C17H34N2O — CID 79122094
N-[4-(ethylamino)cyclohexyl]-N,3,4,4-tetramethylpentanamide (PubChem CID 79122094) has the molecular formula C17H34N2O and a molecular weight of 282.47 g/mol. Its IUPAC name is N-[4-(ethylamino)cyclohexyl]-N,3,4,4-tetramethylpentanamide.
| Compound Name | N-[4-(ethylamino)cyclohexyl]-N,3,4,4-tetramethylpentanamide |
|---|---|
| PubChem CID | 79122094 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | N-[4-(ethylamino)cyclohexyl]-N,3,4,4-tetramethylpentanamide |
| SMILES | CCNC1CCC(N(C)C(=O)CC(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C17H34N2O/c1-7-18-14-8-10-15(11-9-14)19(6)16(20)12-13(2)17(3,4)5/h13-15,18H,7-12H2,1-6H3 |
| InChIKey | UKSACIDLHFURMS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |