C18H35NO — CID 79123292
[1-(aminomethyl)-4-propylcyclohexyl]-(4-methylcyclohexyl)methanol (PubChem CID 79123292) has the molecular formula C18H35NO and a molecular weight of 281.48 g/mol. Its IUPAC name is [1-(aminomethyl)-4-propylcyclohexyl]-(4-methylcyclohexyl)methanol.
| Compound Name | [1-(aminomethyl)-4-propylcyclohexyl]-(4-methylcyclohexyl)methanol |
|---|---|
| PubChem CID | 79123292 |
| Molecular Formula | C18H35NO |
| Molecular Weight | 281.48 g/mol |
| Exact Mass | 281.27 |
| IUPAC Name | [1-(aminomethyl)-4-propylcyclohexyl]-(4-methylcyclohexyl)methanol |
| SMILES | CCCC1CCC(CN)(C(O)C2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C18H35NO/c1-3-4-15-9-11-18(13-19,12-10-15)17(20)16-7-5-14(2)6-8-16/h14-17,20H,3-13,19H2,1-2H3 |
| InChIKey | XQNGCVPAPISRIS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |