About [4-(aminomethyl)-2,3-dihydrochromen-4-yl]-(4-fluorophenyl)methanol
[4-(aminomethyl)-2,3-dihydrochromen-4-yl]-(4-fluorophenyl)methanol (PubChem CID 79123378) has the molecular formula C17H18FNO2
and a molecular weight of 287.33 g/mol. Its IUPAC name is [4-(aminomethyl)-2,3-dihydrochromen-4-yl]-(4-fluorophenyl)methanol.
Molecular Properties
| Compound Name | [4-(aminomethyl)-2,3-dihydrochromen-4-yl]-(4-fluorophenyl)methanol |
| PubChem CID | 79123378 |
| Molecular Formula | C17H18FNO2 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | [4-(aminomethyl)-2,3-dihydrochromen-4-yl]-(4-fluorophenyl)methanol |
| SMILES | NCC1(C(O)c2ccc(F)cc2)CCOc2ccccc21 |
| InChI | InChI=1S/C17H18FNO2/c18-13-7-5-12(6-8-13)16(20)17(11-19)9-10-21-15-4-2-1-3-14(15)17/h1-8,16,20H,9-11,19H2 |
| InChIKey | RNHKWQGEYXHOCL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(aminomethyl)-2,3-dihydrochromen-4-yl]-(4-fluorophenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(aminomethyl)-2,3-dihydrochromen-4-yl]-(4-fluorophenyl)methanol?
The IUPAC name of [4-(aminomethyl)-2,3-dihydrochromen-4-yl]-(4-fluorophenyl)methanol (CID 79123378) is [4-(aminomethyl)-2,3-dihydrochromen-4-yl]-(4-fluorophenyl)methanol.
What is the SMILES notation for [4-(aminomethyl)-2,3-dihydrochromen-4-yl]-(4-fluorophenyl)methanol?
The canonical SMILES for [4-(aminomethyl)-2,3-dihydrochromen-4-yl]-(4-fluorophenyl)methanol is NCC1(C(O)c2ccc(F)cc2)CCOc2ccccc21.
What is the InChIKey of [4-(aminomethyl)-2,3-dihydrochromen-4-yl]-(4-fluorophenyl)methanol?
The InChIKey is RNHKWQGEYXHOCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18FNO2/c18-13-7-5-12(6-8-13)16(20)17(11-19)9-10-21-15-4-2-1-3-14(15)17/h1-8,16,20H,9-11,19H2.
What are the key properties of [4-(aminomethyl)-2,3-dihydrochromen-4-yl]-(4-fluorophenyl)methanol?
[4-(aminomethyl)-2,3-dihydrochromen-4-yl]-(4-fluorophenyl)methanol has a molecular weight of 287.33 g/mol, XLogP of 2.54, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(aminomethyl)-2,3-dihydrochromen-4-yl]-(4-fluorophenyl)methanol is sourced from PubChem (CID 79123378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).