C18H27NO2 — CID 79123419
4-[2-(aminomethyl)-1,3-dihydroinden-2-yl]-2-propyloxan-4-ol (PubChem CID 79123419) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 4-[2-(aminomethyl)-1,3-dihydroinden-2-yl]-2-propyloxan-4-ol.
| Compound Name | 4-[2-(aminomethyl)-1,3-dihydroinden-2-yl]-2-propyloxan-4-ol |
|---|---|
| PubChem CID | 79123419 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 4-[2-(aminomethyl)-1,3-dihydroinden-2-yl]-2-propyloxan-4-ol |
| SMILES | CCCC1CC(O)(C2(CN)Cc3ccccc3C2)CCO1 |
| InChI | InChI=1S/C18H27NO2/c1-2-5-16-12-18(20,8-9-21-16)17(13-19)10-14-6-3-4-7-15(14)11-17/h3-4,6-7,16,20H,2,5,8-13,19H2,1H3 |
| InChIKey | VUAZPEZYPSNIII-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |