About 1-[1-(aminomethyl)-4-propan-2-ylcyclohexyl]-2,2-dimethoxyethanol
1-[1-(aminomethyl)-4-propan-2-ylcyclohexyl]-2,2-dimethoxyethanol (PubChem CID 79123998) has the molecular formula C14H29NO3
and a molecular weight of 259.39 g/mol. Its IUPAC name is 1-[1-(aminomethyl)-4-propan-2-ylcyclohexyl]-2,2-dimethoxyethanol.
Molecular Properties
| Compound Name | 1-[1-(aminomethyl)-4-propan-2-ylcyclohexyl]-2,2-dimethoxyethanol |
| PubChem CID | 79123998 |
| Molecular Formula | C14H29NO3 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | 1-[1-(aminomethyl)-4-propan-2-ylcyclohexyl]-2,2-dimethoxyethanol |
| SMILES | COC(OC)C(O)C1(CN)CCC(C(C)C)CC1 |
| InChI | InChI=1S/C14H29NO3/c1-10(2)11-5-7-14(9-15,8-6-11)12(16)13(17-3)18-4/h10-13,16H,5-9,15H2,1-4H3 |
| InChIKey | VLTCTPDXXMYPIX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-(aminomethyl)-4-propan-2-ylcyclohexyl]-2,2-dimethoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(aminomethyl)-4-propan-2-ylcyclohexyl]-2,2-dimethoxyethanol?
The IUPAC name of 1-[1-(aminomethyl)-4-propan-2-ylcyclohexyl]-2,2-dimethoxyethanol (CID 79123998) is 1-[1-(aminomethyl)-4-propan-2-ylcyclohexyl]-2,2-dimethoxyethanol.
What is the SMILES notation for 1-[1-(aminomethyl)-4-propan-2-ylcyclohexyl]-2,2-dimethoxyethanol?
The canonical SMILES for 1-[1-(aminomethyl)-4-propan-2-ylcyclohexyl]-2,2-dimethoxyethanol is COC(OC)C(O)C1(CN)CCC(C(C)C)CC1.
What is the InChIKey of 1-[1-(aminomethyl)-4-propan-2-ylcyclohexyl]-2,2-dimethoxyethanol?
The InChIKey is VLTCTPDXXMYPIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO3/c1-10(2)11-5-7-14(9-15,8-6-11)12(16)13(17-3)18-4/h10-13,16H,5-9,15H2,1-4H3.
What are the key properties of 1-[1-(aminomethyl)-4-propan-2-ylcyclohexyl]-2,2-dimethoxyethanol?
1-[1-(aminomethyl)-4-propan-2-ylcyclohexyl]-2,2-dimethoxyethanol has a molecular weight of 259.39 g/mol, XLogP of 1.76, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(aminomethyl)-4-propan-2-ylcyclohexyl]-2,2-dimethoxyethanol is sourced from PubChem (CID 79123998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).