C18H24N2O — CID 79124145
[1-(aminomethyl)-3-methylcyclohexyl]-quinolin-4-ylmethanol (PubChem CID 79124145) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is [1-(aminomethyl)-3-methylcyclohexyl]-quinolin-4-ylmethanol.
| Compound Name | [1-(aminomethyl)-3-methylcyclohexyl]-quinolin-4-ylmethanol |
|---|---|
| PubChem CID | 79124145 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | [1-(aminomethyl)-3-methylcyclohexyl]-quinolin-4-ylmethanol |
| SMILES | CC1CCCC(CN)(C(O)c2ccnc3ccccc23)C1 |
| InChI | InChI=1S/C18H24N2O/c1-13-5-4-9-18(11-13,12-19)17(21)15-8-10-20-16-7-3-2-6-14(15)16/h2-3,6-8,10,13,17,21H,4-5,9,11-12,19H2,1H3 |
| InChIKey | GBXUWJFFPWYBNH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |