About 1-[1-(aminomethyl)-3-ethylcyclohexyl]-2,2-dimethoxyethanol
1-[1-(aminomethyl)-3-ethylcyclohexyl]-2,2-dimethoxyethanol (PubChem CID 79124252) has the molecular formula C13H27NO3
and a molecular weight of 245.36 g/mol. Its IUPAC name is 1-[1-(aminomethyl)-3-ethylcyclohexyl]-2,2-dimethoxyethanol.
Molecular Properties
| Compound Name | 1-[1-(aminomethyl)-3-ethylcyclohexyl]-2,2-dimethoxyethanol |
| PubChem CID | 79124252 |
| Molecular Formula | C13H27NO3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | 1-[1-(aminomethyl)-3-ethylcyclohexyl]-2,2-dimethoxyethanol |
| SMILES | CCC1CCCC(CN)(C(O)C(OC)OC)C1 |
| InChI | InChI=1S/C13H27NO3/c1-4-10-6-5-7-13(8-10,9-14)11(15)12(16-2)17-3/h10-12,15H,4-9,14H2,1-3H3 |
| InChIKey | MMJKUIWBYCZATN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-(aminomethyl)-3-ethylcyclohexyl]-2,2-dimethoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(aminomethyl)-3-ethylcyclohexyl]-2,2-dimethoxyethanol?
The IUPAC name of 1-[1-(aminomethyl)-3-ethylcyclohexyl]-2,2-dimethoxyethanol (CID 79124252) is 1-[1-(aminomethyl)-3-ethylcyclohexyl]-2,2-dimethoxyethanol.
What is the SMILES notation for 1-[1-(aminomethyl)-3-ethylcyclohexyl]-2,2-dimethoxyethanol?
The canonical SMILES for 1-[1-(aminomethyl)-3-ethylcyclohexyl]-2,2-dimethoxyethanol is CCC1CCCC(CN)(C(O)C(OC)OC)C1.
What is the InChIKey of 1-[1-(aminomethyl)-3-ethylcyclohexyl]-2,2-dimethoxyethanol?
The InChIKey is MMJKUIWBYCZATN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO3/c1-4-10-6-5-7-13(8-10,9-14)11(15)12(16-2)17-3/h10-12,15H,4-9,14H2,1-3H3.
What are the key properties of 1-[1-(aminomethyl)-3-ethylcyclohexyl]-2,2-dimethoxyethanol?
1-[1-(aminomethyl)-3-ethylcyclohexyl]-2,2-dimethoxyethanol has a molecular weight of 245.36 g/mol, XLogP of 1.51, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(aminomethyl)-3-ethylcyclohexyl]-2,2-dimethoxyethanol is sourced from PubChem (CID 79124252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).