About 2-[2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-yl]-1,1-dimethoxypropan-2-ol
2-[2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-yl]-1,1-dimethoxypropan-2-ol (PubChem CID 79125062) has the molecular formula C16H25NO3
and a molecular weight of 279.38 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-yl]-1,1-dimethoxypropan-2-ol.
Molecular Properties
| Compound Name | 2-[2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-yl]-1,1-dimethoxypropan-2-ol |
| PubChem CID | 79125062 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 2-[2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-yl]-1,1-dimethoxypropan-2-ol |
| SMILES | COC(OC)C(C)(O)C1(CN)CCc2ccccc2C1 |
| InChI | InChI=1S/C16H25NO3/c1-15(18,14(19-2)20-3)16(11-17)9-8-12-6-4-5-7-13(12)10-16/h4-7,14,18H,8-11,17H2,1-3H3 |
| InChIKey | HJCBAFMTNVWSFC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-yl]-1,1-dimethoxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-yl]-1,1-dimethoxypropan-2-ol?
The IUPAC name of 2-[2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-yl]-1,1-dimethoxypropan-2-ol (CID 79125062) is 2-[2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-yl]-1,1-dimethoxypropan-2-ol.
What is the SMILES notation for 2-[2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-yl]-1,1-dimethoxypropan-2-ol?
The canonical SMILES for 2-[2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-yl]-1,1-dimethoxypropan-2-ol is COC(OC)C(C)(O)C1(CN)CCc2ccccc2C1.
What is the InChIKey of 2-[2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-yl]-1,1-dimethoxypropan-2-ol?
The InChIKey is HJCBAFMTNVWSFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO3/c1-15(18,14(19-2)20-3)16(11-17)9-8-12-6-4-5-7-13(12)10-16/h4-7,14,18H,8-11,17H2,1-3H3.
What are the key properties of 2-[2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-yl]-1,1-dimethoxypropan-2-ol?
2-[2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-yl]-1,1-dimethoxypropan-2-ol has a molecular weight of 279.38 g/mol, XLogP of 1.49, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-yl]-1,1-dimethoxypropan-2-ol is sourced from PubChem (CID 79125062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).