C19H31NO — CID 79125512
1-[1-(aminomethyl)-4,4-dimethylcyclohexyl]-1-phenylbutan-1-ol (PubChem CID 79125512) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is 1-[1-(aminomethyl)-4,4-dimethylcyclohexyl]-1-phenylbutan-1-ol.
| Compound Name | 1-[1-(aminomethyl)-4,4-dimethylcyclohexyl]-1-phenylbutan-1-ol |
|---|---|
| PubChem CID | 79125512 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | 1-[1-(aminomethyl)-4,4-dimethylcyclohexyl]-1-phenylbutan-1-ol |
| SMILES | CCCC(O)(c1ccccc1)C1(CN)CCC(C)(C)CC1 |
| InChI | InChI=1S/C19H31NO/c1-4-10-19(21,16-8-6-5-7-9-16)18(15-20)13-11-17(2,3)12-14-18/h5-9,21H,4,10-15,20H2,1-3H3 |
| InChIKey | WXVTVPQWSGFUPU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |