C17H26BrNO2 — CID 79126020
[1-(aminomethyl)-3-ethylcyclohexyl]-(5-bromo-2-methoxyphenyl)methanol (PubChem CID 79126020) has the molecular formula C17H26BrNO2 and a molecular weight of 356.30 g/mol. Its IUPAC name is [1-(aminomethyl)-3-ethylcyclohexyl]-(5-bromo-2-methoxyphenyl)methanol.
| Compound Name | [1-(aminomethyl)-3-ethylcyclohexyl]-(5-bromo-2-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 79126020 |
| Molecular Formula | C17H26BrNO2 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | [1-(aminomethyl)-3-ethylcyclohexyl]-(5-bromo-2-methoxyphenyl)methanol |
| SMILES | CCC1CCCC(CN)(C(O)c2cc(Br)ccc2OC)C1 |
| InChI | InChI=1S/C17H26BrNO2/c1-3-12-5-4-8-17(10-12,11-19)16(20)14-9-13(18)6-7-15(14)21-2/h6-7,9,12,16,20H,3-5,8,10-11,19H2,1-2H3 |
| InChIKey | JBAKYRRSYFHTHW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |