About 1-[1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-4-methylcycloheptan-1-ol
1-[1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-4-methylcycloheptan-1-ol (PubChem CID 79126068) has the molecular formula C19H29NO
and a molecular weight of 287.45 g/mol. Its IUPAC name is 1-[1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-4-methylcycloheptan-1-ol.
Molecular Properties
| Compound Name | 1-[1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-4-methylcycloheptan-1-ol |
| PubChem CID | 79126068 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 1-[1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-4-methylcycloheptan-1-ol |
| SMILES | CC1CCCC(O)(C2(CN)CCCc3ccccc32)CC1 |
| InChI | InChI=1S/C19H29NO/c1-15-6-4-12-19(21,13-10-15)18(14-20)11-5-8-16-7-2-3-9-17(16)18/h2-3,7,9,15,21H,4-6,8,10-14,20H2,1H3 |
| InChIKey | QGJDINAUTYZCIN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-4-methylcycloheptan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-4-methylcycloheptan-1-ol?
The IUPAC name of 1-[1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-4-methylcycloheptan-1-ol (CID 79126068) is 1-[1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-4-methylcycloheptan-1-ol.
What is the SMILES notation for 1-[1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-4-methylcycloheptan-1-ol?
The canonical SMILES for 1-[1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-4-methylcycloheptan-1-ol is CC1CCCC(O)(C2(CN)CCCc3ccccc32)CC1.
What is the InChIKey of 1-[1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-4-methylcycloheptan-1-ol?
The InChIKey is QGJDINAUTYZCIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29NO/c1-15-6-4-12-19(21,13-10-15)18(14-20)11-5-8-16-7-2-3-9-17(16)18/h2-3,7,9,15,21H,4-6,8,10-14,20H2,1H3.
What are the key properties of 1-[1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-4-methylcycloheptan-1-ol?
1-[1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-4-methylcycloheptan-1-ol has a molecular weight of 287.45 g/mol, XLogP of 3.55, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-4-methylcycloheptan-1-ol is sourced from PubChem (CID 79126068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).