About 1-(1-hydroxy-2,2-dimethoxyethyl)cyclobutane-1-carbonitrile
1-(1-hydroxy-2,2-dimethoxyethyl)cyclobutane-1-carbonitrile (PubChem CID 79128068) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is 1-(1-hydroxy-2,2-dimethoxyethyl)cyclobutane-1-carbonitrile.
Molecular Properties
| Compound Name | 1-(1-hydroxy-2,2-dimethoxyethyl)cyclobutane-1-carbonitrile |
| PubChem CID | 79128068 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 1-(1-hydroxy-2,2-dimethoxyethyl)cyclobutane-1-carbonitrile |
| SMILES | COC(OC)C(O)C1(C#N)CCC1 |
| InChI | InChI=1S/C9H15NO3/c1-12-8(13-2)7(11)9(6-10)4-3-5-9/h7-8,11H,3-5H2,1-2H3 |
| InChIKey | QARKGUOZWZRYDY-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-hydroxy-2,2-dimethoxyethyl)cyclobutane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-hydroxy-2,2-dimethoxyethyl)cyclobutane-1-carbonitrile?
The IUPAC name of 1-(1-hydroxy-2,2-dimethoxyethyl)cyclobutane-1-carbonitrile (CID 79128068) is 1-(1-hydroxy-2,2-dimethoxyethyl)cyclobutane-1-carbonitrile.
What is the SMILES notation for 1-(1-hydroxy-2,2-dimethoxyethyl)cyclobutane-1-carbonitrile?
The canonical SMILES for 1-(1-hydroxy-2,2-dimethoxyethyl)cyclobutane-1-carbonitrile is COC(OC)C(O)C1(C#N)CCC1.
What is the InChIKey of 1-(1-hydroxy-2,2-dimethoxyethyl)cyclobutane-1-carbonitrile?
The InChIKey is QARKGUOZWZRYDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3/c1-12-8(13-2)7(11)9(6-10)4-3-5-9/h7-8,11H,3-5H2,1-2H3.
What are the key properties of 1-(1-hydroxy-2,2-dimethoxyethyl)cyclobutane-1-carbonitrile?
1-(1-hydroxy-2,2-dimethoxyethyl)cyclobutane-1-carbonitrile has a molecular weight of 185.22 g/mol, XLogP of 0.66, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-hydroxy-2,2-dimethoxyethyl)cyclobutane-1-carbonitrile is sourced from PubChem (CID 79128068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).