About 4-(2-hydroxy-1,1-dimethoxypropan-2-yl)oxane-4-carbonitrile
4-(2-hydroxy-1,1-dimethoxypropan-2-yl)oxane-4-carbonitrile (PubChem CID 79128616) has the molecular formula C11H19NO4
and a molecular weight of 229.28 g/mol. Its IUPAC name is 4-(2-hydroxy-1,1-dimethoxypropan-2-yl)oxane-4-carbonitrile.
Molecular Properties
| Compound Name | 4-(2-hydroxy-1,1-dimethoxypropan-2-yl)oxane-4-carbonitrile |
| PubChem CID | 79128616 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 4-(2-hydroxy-1,1-dimethoxypropan-2-yl)oxane-4-carbonitrile |
| SMILES | COC(OC)C(C)(O)C1(C#N)CCOCC1 |
| InChI | InChI=1S/C11H19NO4/c1-10(13,9(14-2)15-3)11(8-12)4-6-16-7-5-11/h9,13H,4-7H2,1-3H3 |
| InChIKey | LRKGRRJXRKIAQK-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 71.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-hydroxy-1,1-dimethoxypropan-2-yl)oxane-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-hydroxy-1,1-dimethoxypropan-2-yl)oxane-4-carbonitrile?
The IUPAC name of 4-(2-hydroxy-1,1-dimethoxypropan-2-yl)oxane-4-carbonitrile (CID 79128616) is 4-(2-hydroxy-1,1-dimethoxypropan-2-yl)oxane-4-carbonitrile.
What is the SMILES notation for 4-(2-hydroxy-1,1-dimethoxypropan-2-yl)oxane-4-carbonitrile?
The canonical SMILES for 4-(2-hydroxy-1,1-dimethoxypropan-2-yl)oxane-4-carbonitrile is COC(OC)C(C)(O)C1(C#N)CCOCC1.
What is the InChIKey of 4-(2-hydroxy-1,1-dimethoxypropan-2-yl)oxane-4-carbonitrile?
The InChIKey is LRKGRRJXRKIAQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO4/c1-10(13,9(14-2)15-3)11(8-12)4-6-16-7-5-11/h9,13H,4-7H2,1-3H3.
What are the key properties of 4-(2-hydroxy-1,1-dimethoxypropan-2-yl)oxane-4-carbonitrile?
4-(2-hydroxy-1,1-dimethoxypropan-2-yl)oxane-4-carbonitrile has a molecular weight of 229.28 g/mol, XLogP of 0.68, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-hydroxy-1,1-dimethoxypropan-2-yl)oxane-4-carbonitrile is sourced from PubChem (CID 79128616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).