C14H23NO — CID 79128942
1-(4-ethyl-1-hydroxycycloheptyl)cyclobutane-1-carbonitrile (PubChem CID 79128942) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 1-(4-ethyl-1-hydroxycycloheptyl)cyclobutane-1-carbonitrile.
| Compound Name | 1-(4-ethyl-1-hydroxycycloheptyl)cyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 79128942 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 1-(4-ethyl-1-hydroxycycloheptyl)cyclobutane-1-carbonitrile |
| SMILES | CCC1CCCC(O)(C2(C#N)CCC2)CC1 |
| InChI | InChI=1S/C14H23NO/c1-2-12-5-3-9-14(16,10-6-12)13(11-15)7-4-8-13/h12,16H,2-10H2,1H3 |
| InChIKey | WMOVVOYWCAYSNH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |