C13H23NO — CID 79131191
3-ethyl-1-(2-hydroxybutan-2-yl)cyclohexane-1-carbonitrile (PubChem CID 79131191) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 3-ethyl-1-(2-hydroxybutan-2-yl)cyclohexane-1-carbonitrile.
| Compound Name | 3-ethyl-1-(2-hydroxybutan-2-yl)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 79131191 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 3-ethyl-1-(2-hydroxybutan-2-yl)cyclohexane-1-carbonitrile |
| SMILES | CCC1CCCC(C#N)(C(C)(O)CC)C1 |
| InChI | InChI=1S/C13H23NO/c1-4-11-7-6-8-13(9-11,10-14)12(3,15)5-2/h11,15H,4-9H2,1-3H3 |
| InChIKey | OJONJHXHUIVTLU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |