About 1-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-4-phenylpiperazine
1-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-4-phenylpiperazine (PubChem CID 791323) has the molecular formula C18H19N3O4
and a molecular weight of 341.37 g/mol. Its IUPAC name is 1-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-4-phenylpiperazine.
Molecular Properties
| Compound Name | 1-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-4-phenylpiperazine |
| PubChem CID | 791323 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 1-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-4-phenylpiperazine |
| SMILES | O=[N+]([O-])c1cc2c(cc1CN1CCN(c3ccccc3)CC1)OCO2 |
| InChI | InChI=1S/C18H19N3O4/c22-21(23)16-11-18-17(24-13-25-18)10-14(16)12-19-6-8-20(9-7-19)15-4-2-1-3-5-15/h1-5,10-11H,6-9,12-13H2 |
| InChIKey | IBQQPXWQLSZVTE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 68.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-4-phenylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-4-phenylpiperazine?
The IUPAC name of 1-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-4-phenylpiperazine (CID 791323) is 1-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-4-phenylpiperazine.
What is the SMILES notation for 1-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-4-phenylpiperazine?
The canonical SMILES for 1-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-4-phenylpiperazine is O=[N+]([O-])c1cc2c(cc1CN1CCN(c3ccccc3)CC1)OCO2.
What is the InChIKey of 1-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-4-phenylpiperazine?
The InChIKey is IBQQPXWQLSZVTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O4/c22-21(23)16-11-18-17(24-13-25-18)10-14(16)12-19-6-8-20(9-7-19)15-4-2-1-3-5-15/h1-5,10-11H,6-9,12-13H2.
What are the key properties of 1-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-4-phenylpiperazine?
1-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-4-phenylpiperazine has a molecular weight of 341.37 g/mol, XLogP of 2.65, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-4-phenylpiperazine is sourced from PubChem (CID 791323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).