C17H23NO — CID 79132331
1-[(2-ethylphenyl)-hydroxymethyl]-3-methylcyclohexane-1-carbonitrile (PubChem CID 79132331) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 1-[(2-ethylphenyl)-hydroxymethyl]-3-methylcyclohexane-1-carbonitrile.
| Compound Name | 1-[(2-ethylphenyl)-hydroxymethyl]-3-methylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 79132331 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 1-[(2-ethylphenyl)-hydroxymethyl]-3-methylcyclohexane-1-carbonitrile |
| SMILES | CCc1ccccc1C(O)C1(C#N)CCCC(C)C1 |
| InChI | InChI=1S/C17H23NO/c1-3-14-8-4-5-9-15(14)16(19)17(12-18)10-6-7-13(2)11-17/h4-5,8-9,13,16,19H,3,6-7,10-11H2,1-2H3 |
| InChIKey | FHFWWXUZJHBDLB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |