About 1-(1-hydroxy-4,4-dimethylcyclohexyl)-4-propan-2-ylcyclohexane-1-carbonitrile
1-(1-hydroxy-4,4-dimethylcyclohexyl)-4-propan-2-ylcyclohexane-1-carbonitrile (PubChem CID 79133079) has the molecular formula C18H31NO
and a molecular weight of 277.45 g/mol. Its IUPAC name is 1-(1-hydroxy-4,4-dimethylcyclohexyl)-4-propan-2-ylcyclohexane-1-carbonitrile.
Molecular Properties
| Compound Name | 1-(1-hydroxy-4,4-dimethylcyclohexyl)-4-propan-2-ylcyclohexane-1-carbonitrile |
| PubChem CID | 79133079 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 1-(1-hydroxy-4,4-dimethylcyclohexyl)-4-propan-2-ylcyclohexane-1-carbonitrile |
| SMILES | CC(C)C1CCC(C#N)(C2(O)CCC(C)(C)CC2)CC1 |
| InChI | InChI=1S/C18H31NO/c1-14(2)15-5-7-17(13-19,8-6-15)18(20)11-9-16(3,4)10-12-18/h14-15,20H,5-12H2,1-4H3 |
| InChIKey | RDYKPNZDPVKXOQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1-hydroxy-4,4-dimethylcyclohexyl)-4-propan-2-ylcyclohexane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-hydroxy-4,4-dimethylcyclohexyl)-4-propan-2-ylcyclohexane-1-carbonitrile?
The IUPAC name of 1-(1-hydroxy-4,4-dimethylcyclohexyl)-4-propan-2-ylcyclohexane-1-carbonitrile (CID 79133079) is 1-(1-hydroxy-4,4-dimethylcyclohexyl)-4-propan-2-ylcyclohexane-1-carbonitrile.
What is the SMILES notation for 1-(1-hydroxy-4,4-dimethylcyclohexyl)-4-propan-2-ylcyclohexane-1-carbonitrile?
The canonical SMILES for 1-(1-hydroxy-4,4-dimethylcyclohexyl)-4-propan-2-ylcyclohexane-1-carbonitrile is CC(C)C1CCC(C#N)(C2(O)CCC(C)(C)CC2)CC1.
What is the InChIKey of 1-(1-hydroxy-4,4-dimethylcyclohexyl)-4-propan-2-ylcyclohexane-1-carbonitrile?
The InChIKey is RDYKPNZDPVKXOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31NO/c1-14(2)15-5-7-17(13-19,8-6-15)18(20)11-9-16(3,4)10-12-18/h14-15,20H,5-12H2,1-4H3.
What are the key properties of 1-(1-hydroxy-4,4-dimethylcyclohexyl)-4-propan-2-ylcyclohexane-1-carbonitrile?
1-(1-hydroxy-4,4-dimethylcyclohexyl)-4-propan-2-ylcyclohexane-1-carbonitrile has a molecular weight of 277.45 g/mol, XLogP of 4.67, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-hydroxy-4,4-dimethylcyclohexyl)-4-propan-2-ylcyclohexane-1-carbonitrile is sourced from PubChem (CID 79133079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).