C13H16ClN3S — CID 79133368
4-chloro-3-[(3-propylimidazol-4-yl)methylsulfanyl]aniline (PubChem CID 79133368) has the molecular formula C13H16ClN3S and a molecular weight of 281.81 g/mol. Its IUPAC name is 4-chloro-3-[(3-propylimidazol-4-yl)methylsulfanyl]aniline.
| Compound Name | 4-chloro-3-[(3-propylimidazol-4-yl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 79133368 |
| Molecular Formula | C13H16ClN3S |
| Molecular Weight | 281.81 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 4-chloro-3-[(3-propylimidazol-4-yl)methylsulfanyl]aniline |
| SMILES | CCCn1cncc1CSc1cc(N)ccc1Cl |
| InChI | InChI=1S/C13H16ClN3S/c1-2-5-17-9-16-7-11(17)8-18-13-6-10(15)3-4-12(13)14/h3-4,6-7,9H,2,5,8,15H2,1H3 |
| InChIKey | KDASGFUOMLMCFC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.81 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|