C13H11Cl2NS — CID 79134418
3-[(2,5-dichlorophenyl)methylsulfanyl]aniline (PubChem CID 79134418) has the molecular formula C13H11Cl2NS and a molecular weight of 284.21 g/mol. Its IUPAC name is 3-[(2,5-dichlorophenyl)methylsulfanyl]aniline.
| Compound Name | 3-[(2,5-dichlorophenyl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 79134418 |
| Molecular Formula | C13H11Cl2NS |
| Molecular Weight | 284.21 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 3-[(2,5-dichlorophenyl)methylsulfanyl]aniline |
| SMILES | Nc1cccc(SCc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C13H11Cl2NS/c14-10-4-5-13(15)9(6-10)8-17-12-3-1-2-11(16)7-12/h1-7H,8,16H2 |
| InChIKey | GLKUAZKDAUCWJO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.21 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|