About [1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-(furan-2-yl)methanol
[1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-(furan-2-yl)methanol (PubChem CID 79134701) has the molecular formula C16H19NO2
and a molecular weight of 257.33 g/mol. Its IUPAC name is [1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-(furan-2-yl)methanol.
Molecular Properties
| Compound Name | [1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-(furan-2-yl)methanol |
| PubChem CID | 79134701 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | [1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-(furan-2-yl)methanol |
| SMILES | NCC1(C(O)c2ccco2)CCCc2ccccc21 |
| InChI | InChI=1S/C16H19NO2/c17-11-16(15(18)14-8-4-10-19-14)9-3-6-12-5-1-2-7-13(12)16/h1-2,4-5,7-8,10,15,18H,3,6,9,11,17H2 |
| InChIKey | BBDVLCJQGVGBKM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-(furan-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-(furan-2-yl)methanol?
The IUPAC name of [1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-(furan-2-yl)methanol (CID 79134701) is [1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-(furan-2-yl)methanol.
What is the SMILES notation for [1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-(furan-2-yl)methanol?
The canonical SMILES for [1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-(furan-2-yl)methanol is NCC1(C(O)c2ccco2)CCCc2ccccc21.
What is the InChIKey of [1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-(furan-2-yl)methanol?
The InChIKey is BBDVLCJQGVGBKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO2/c17-11-16(15(18)14-8-4-10-19-14)9-3-6-12-5-1-2-7-13(12)16/h1-2,4-5,7-8,10,15,18H,3,6,9,11,17H2.
What are the key properties of [1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-(furan-2-yl)methanol?
[1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-(furan-2-yl)methanol has a molecular weight of 257.33 g/mol, XLogP of 2.55, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]-(furan-2-yl)methanol is sourced from PubChem (CID 79134701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).