C15H29NO2 — CID 79135491
4-[1-(aminomethyl)-4-propylcyclohexyl]oxan-4-ol (PubChem CID 79135491) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is 4-[1-(aminomethyl)-4-propylcyclohexyl]oxan-4-ol.
| Compound Name | 4-[1-(aminomethyl)-4-propylcyclohexyl]oxan-4-ol |
|---|---|
| PubChem CID | 79135491 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | 4-[1-(aminomethyl)-4-propylcyclohexyl]oxan-4-ol |
| SMILES | CCCC1CCC(CN)(C2(O)CCOCC2)CC1 |
| InChI | InChI=1S/C15H29NO2/c1-2-3-13-4-6-14(12-16,7-5-13)15(17)8-10-18-11-9-15/h13,17H,2-12,16H2,1H3 |
| InChIKey | VGKJSFULFKRZJA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |