C14H25NO — CID 79136524
3-ethyl-1-(2-ethyl-1-hydroxybutyl)cyclopentane-1-carbonitrile (PubChem CID 79136524) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is 3-ethyl-1-(2-ethyl-1-hydroxybutyl)cyclopentane-1-carbonitrile.
| Compound Name | 3-ethyl-1-(2-ethyl-1-hydroxybutyl)cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 79136524 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 3-ethyl-1-(2-ethyl-1-hydroxybutyl)cyclopentane-1-carbonitrile |
| SMILES | CCC1CCC(C#N)(C(O)C(CC)CC)C1 |
| InChI | InChI=1S/C14H25NO/c1-4-11-7-8-14(9-11,10-15)13(16)12(5-2)6-3/h11-13,16H,4-9H2,1-3H3 |
| InChIKey | GHKYXSBLNYCKRQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |