About [1-(aminomethyl)-4,4-dimethylcyclohexyl]-cyclohex-3-en-1-ylmethanol
[1-(aminomethyl)-4,4-dimethylcyclohexyl]-cyclohex-3-en-1-ylmethanol (PubChem CID 79137924) has the molecular formula C16H29NO
and a molecular weight of 251.41 g/mol. Its IUPAC name is [1-(aminomethyl)-4,4-dimethylcyclohexyl]-cyclohex-3-en-1-ylmethanol.
Molecular Properties
| Compound Name | [1-(aminomethyl)-4,4-dimethylcyclohexyl]-cyclohex-3-en-1-ylmethanol |
| PubChem CID | 79137924 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | [1-(aminomethyl)-4,4-dimethylcyclohexyl]-cyclohex-3-en-1-ylmethanol |
| SMILES | CC1(C)CCC(CN)(C(O)C2CC=CCC2)CC1 |
| InChI | InChI=1S/C16H29NO/c1-15(2)8-10-16(12-17,11-9-15)14(18)13-6-4-3-5-7-13/h3-4,13-14,18H,5-12,17H2,1-2H3 |
| InChIKey | JRUQROZWXQXKPY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [1-(aminomethyl)-4,4-dimethylcyclohexyl]-cyclohex-3-en-1-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(aminomethyl)-4,4-dimethylcyclohexyl]-cyclohex-3-en-1-ylmethanol?
The IUPAC name of [1-(aminomethyl)-4,4-dimethylcyclohexyl]-cyclohex-3-en-1-ylmethanol (CID 79137924) is [1-(aminomethyl)-4,4-dimethylcyclohexyl]-cyclohex-3-en-1-ylmethanol.
What is the SMILES notation for [1-(aminomethyl)-4,4-dimethylcyclohexyl]-cyclohex-3-en-1-ylmethanol?
The canonical SMILES for [1-(aminomethyl)-4,4-dimethylcyclohexyl]-cyclohex-3-en-1-ylmethanol is CC1(C)CCC(CN)(C(O)C2CC=CCC2)CC1.
What is the InChIKey of [1-(aminomethyl)-4,4-dimethylcyclohexyl]-cyclohex-3-en-1-ylmethanol?
The InChIKey is JRUQROZWXQXKPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29NO/c1-15(2)8-10-16(12-17,11-9-15)14(18)13-6-4-3-5-7-13/h3-4,13-14,18H,5-12,17H2,1-2H3.
What are the key properties of [1-(aminomethyl)-4,4-dimethylcyclohexyl]-cyclohex-3-en-1-ylmethanol?
[1-(aminomethyl)-4,4-dimethylcyclohexyl]-cyclohex-3-en-1-ylmethanol has a molecular weight of 251.41 g/mol, XLogP of 3.25, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(aminomethyl)-4,4-dimethylcyclohexyl]-cyclohex-3-en-1-ylmethanol is sourced from PubChem (CID 79137924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).