C10H8BrFN2O — CID 79139421
[5-(4-bromo-3-fluorophenyl)-1,3-oxazol-4-yl]methanamine (PubChem CID 79139421) has the molecular formula C10H8BrFN2O and a molecular weight of 271.09 g/mol. Its IUPAC name is [5-(4-bromo-3-fluorophenyl)-1,3-oxazol-4-yl]methanamine.
| Compound Name | [5-(4-bromo-3-fluorophenyl)-1,3-oxazol-4-yl]methanamine |
|---|---|
| PubChem CID | 79139421 |
| Molecular Formula | C10H8BrFN2O |
| Molecular Weight | 271.09 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | [5-(4-bromo-3-fluorophenyl)-1,3-oxazol-4-yl]methanamine |
| SMILES | NCc1ncoc1-c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C10H8BrFN2O/c11-7-2-1-6(3-8(7)12)10-9(4-13)14-5-15-10/h1-3,5H,4,13H2 |
| InChIKey | HZEXEVSKINSEMT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.09 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |