C10H9ClN2O — CID 79139636
[5-(2-chlorophenyl)-1,3-oxazol-4-yl]methanamine (PubChem CID 79139636) has the molecular formula C10H9ClN2O and a molecular weight of 208.65 g/mol. Its IUPAC name is [5-(2-chlorophenyl)-1,3-oxazol-4-yl]methanamine.
| Compound Name | [5-(2-chlorophenyl)-1,3-oxazol-4-yl]methanamine |
|---|---|
| PubChem CID | 79139636 |
| Molecular Formula | C10H9ClN2O |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | [5-(2-chlorophenyl)-1,3-oxazol-4-yl]methanamine |
| SMILES | NCc1ncoc1-c1ccccc1Cl |
| InChI | InChI=1S/C10H9ClN2O/c11-8-4-2-1-3-7(8)10-9(5-12)13-6-14-10/h1-4,6H,5,12H2 |
| InChIKey | AJOCTJHPTICNSL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |