About N,N-dimethyl-3-[4-(methylaminomethyl)-1,3-oxazol-5-yl]aniline
N,N-dimethyl-3-[4-(methylaminomethyl)-1,3-oxazol-5-yl]aniline (PubChem CID 79139650) has the molecular formula C13H17N3O
and a molecular weight of 231.30 g/mol. Its IUPAC name is N,N-dimethyl-3-[4-(methylaminomethyl)-1,3-oxazol-5-yl]aniline.
Molecular Properties
| Compound Name | N,N-dimethyl-3-[4-(methylaminomethyl)-1,3-oxazol-5-yl]aniline |
| PubChem CID | 79139650 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | N,N-dimethyl-3-[4-(methylaminomethyl)-1,3-oxazol-5-yl]aniline |
| SMILES | CNCc1ncoc1-c1cccc(N(C)C)c1 |
| InChI | InChI=1S/C13H17N3O/c1-14-8-12-13(17-9-15-12)10-5-4-6-11(7-10)16(2)3/h4-7,9,14H,8H2,1-3H3 |
| InChIKey | AWHBQFIFQUNJTO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-dimethyl-3-[4-(methylaminomethyl)-1,3-oxazol-5-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-3-[4-(methylaminomethyl)-1,3-oxazol-5-yl]aniline?
The IUPAC name of N,N-dimethyl-3-[4-(methylaminomethyl)-1,3-oxazol-5-yl]aniline (CID 79139650) is N,N-dimethyl-3-[4-(methylaminomethyl)-1,3-oxazol-5-yl]aniline.
What is the SMILES notation for N,N-dimethyl-3-[4-(methylaminomethyl)-1,3-oxazol-5-yl]aniline?
The canonical SMILES for N,N-dimethyl-3-[4-(methylaminomethyl)-1,3-oxazol-5-yl]aniline is CNCc1ncoc1-c1cccc(N(C)C)c1.
What is the InChIKey of N,N-dimethyl-3-[4-(methylaminomethyl)-1,3-oxazol-5-yl]aniline?
The InChIKey is AWHBQFIFQUNJTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O/c1-14-8-12-13(17-9-15-12)10-5-4-6-11(7-10)16(2)3/h4-7,9,14H,8H2,1-3H3.
What are the key properties of N,N-dimethyl-3-[4-(methylaminomethyl)-1,3-oxazol-5-yl]aniline?
N,N-dimethyl-3-[4-(methylaminomethyl)-1,3-oxazol-5-yl]aniline has a molecular weight of 231.30 g/mol, XLogP of 2.13, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-3-[4-(methylaminomethyl)-1,3-oxazol-5-yl]aniline is sourced from PubChem (CID 79139650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).