About (5-cyclopropyl-1,3-oxazol-4-yl)methanamine
(5-cyclopropyl-1,3-oxazol-4-yl)methanamine (PubChem CID 79139937) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is (5-cyclopropyl-1,3-oxazol-4-yl)methanamine.
Molecular Properties
| Compound Name | (5-cyclopropyl-1,3-oxazol-4-yl)methanamine |
| PubChem CID | 79139937 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | (5-cyclopropyl-1,3-oxazol-4-yl)methanamine |
| SMILES | NCc1ncoc1C1CC1 |
| InChI | InChI=1S/C7H10N2O/c8-3-6-7(5-1-2-5)10-4-9-6/h4-5H,1-3,8H2 |
| InChIKey | KYUCQLPLNZQLIV-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-cyclopropyl-1,3-oxazol-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-cyclopropyl-1,3-oxazol-4-yl)methanamine?
The IUPAC name of (5-cyclopropyl-1,3-oxazol-4-yl)methanamine (CID 79139937) is (5-cyclopropyl-1,3-oxazol-4-yl)methanamine.
What is the SMILES notation for (5-cyclopropyl-1,3-oxazol-4-yl)methanamine?
The canonical SMILES for (5-cyclopropyl-1,3-oxazol-4-yl)methanamine is NCc1ncoc1C1CC1.
What is the InChIKey of (5-cyclopropyl-1,3-oxazol-4-yl)methanamine?
The InChIKey is KYUCQLPLNZQLIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O/c8-3-6-7(5-1-2-5)10-4-9-6/h4-5H,1-3,8H2.
What are the key properties of (5-cyclopropyl-1,3-oxazol-4-yl)methanamine?
(5-cyclopropyl-1,3-oxazol-4-yl)methanamine has a molecular weight of 138.17 g/mol, XLogP of 1.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-cyclopropyl-1,3-oxazol-4-yl)methanamine is sourced from PubChem (CID 79139937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).