C13H16FN3OS — CID 79141031
4-[(3-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-2-fluoroaniline (PubChem CID 79141031) has the molecular formula C13H16FN3OS and a molecular weight of 281.36 g/mol. Its IUPAC name is 4-[(3-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-2-fluoroaniline.
| Compound Name | 4-[(3-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-2-fluoroaniline |
|---|---|
| PubChem CID | 79141031 |
| Molecular Formula | C13H16FN3OS |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 4-[(3-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-2-fluoroaniline |
| SMILES | CCCCc1noc(CSc2ccc(N)c(F)c2)n1 |
| InChI | InChI=1S/C13H16FN3OS/c1-2-3-4-12-16-13(18-17-12)8-19-9-5-6-11(15)10(14)7-9/h5-7H,2-4,8,15H2,1H3 |
| InChIKey | YMSHOFAAFDWDNA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|