C11H13N3OS — CID 79141432
2-(5-amino-2-methylphenyl)sulfanyl-N-(cyanomethyl)acetamide (PubChem CID 79141432) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 2-(5-amino-2-methylphenyl)sulfanyl-N-(cyanomethyl)acetamide.
| Compound Name | 2-(5-amino-2-methylphenyl)sulfanyl-N-(cyanomethyl)acetamide |
|---|---|
| PubChem CID | 79141432 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-(5-amino-2-methylphenyl)sulfanyl-N-(cyanomethyl)acetamide |
| SMILES | Cc1ccc(N)cc1SCC(=O)NCC#N |
| InChI | InChI=1S/C11H13N3OS/c1-8-2-3-9(13)6-10(8)16-7-11(15)14-5-4-12/h2-3,6H,5,7,13H2,1H3,(H,14,15) |
| InChIKey | ZLNATXCONPFFBU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|