C15H24N2OS — CID 79141696
4-(5-amino-2-methylphenyl)sulfanyl-N,N-diethylbutanamide (PubChem CID 79141696) has the molecular formula C15H24N2OS and a molecular weight of 280.44 g/mol. Its IUPAC name is 4-(5-amino-2-methylphenyl)sulfanyl-N,N-diethylbutanamide.
| Compound Name | 4-(5-amino-2-methylphenyl)sulfanyl-N,N-diethylbutanamide |
|---|---|
| PubChem CID | 79141696 |
| Molecular Formula | C15H24N2OS |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 4-(5-amino-2-methylphenyl)sulfanyl-N,N-diethylbutanamide |
| SMILES | CCN(CC)C(=O)CCCSc1cc(N)ccc1C |
| InChI | InChI=1S/C15H24N2OS/c1-4-17(5-2)15(18)7-6-10-19-14-11-13(16)9-8-12(14)3/h8-9,11H,4-7,10,16H2,1-3H3 |
| InChIKey | HWYFBPBDXOEZQG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|