2-(6-methyl-1,3-benzothiazol-2-yl)cyclopropane-1-carboxylic acid

C12H11NO2S — CID 79142019

IUPAC2-(6-methyl-1,3-benzothiazol-2-yl)cyclopropane-1-carboxylic acid
SMILESCc1ccc2nc(C3CC3C(=O)O)sc2c1
InChIInChI=1S/C12H11NO2S/c1-6-2-3-9-10(4-6)16-11(13-9)7-5-8(7)12(14)15/h2-4,7-8H,5H2,1H3,(H,14,15)
InChIKeyHLURSGXKLUTMQF-UHFFFAOYSA-N
MW233.29 g/mol
LogP2.79
Rot. Bonds2

About 2-(6-methyl-1,3-benzothiazol-2-yl)cyclopropane-1-carboxylic acid

2-(6-methyl-1,3-benzothiazol-2-yl)cyclopropane-1-carboxylic acid (PubChem CID 79142019) has the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. Its IUPAC name is 2-(6-methyl-1,3-benzothiazol-2-yl)cyclopropane-1-carboxylic acid.

Molecular Properties

Compound Name2-(6-methyl-1,3-benzothiazol-2-yl)cyclopropane-1-carboxylic acid
PubChem CID79142019
Molecular FormulaC12H11NO2S
Molecular Weight233.29 g/mol
Exact Mass233.05
IUPAC Name2-(6-methyl-1,3-benzothiazol-2-yl)cyclopropane-1-carboxylic acid
SMILESCc1ccc2nc(C3CC3C(=O)O)sc2c1
InChIInChI=1S/C12H11NO2S/c1-6-2-3-9-10(4-6)16-11(13-9)7-5-8(7)12(14)15/h2-4,7-8H,5H2,1H3,(H,14,15)
InChIKeyHLURSGXKLUTMQF-UHFFFAOYSA-N
XLogP2.79
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.29
LogP ≤ 52.79
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(6-methyl-1,3-benzothiazol-2-yl)cyclopropane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-methyl-1,3-benzothiazol-2-yl)cyclopropane-1-carboxylic acid?
The IUPAC name of 2-(6-methyl-1,3-benzothiazol-2-yl)cyclopropane-1-carboxylic acid (CID 79142019) is 2-(6-methyl-1,3-benzothiazol-2-yl)cyclopropane-1-carboxylic acid.
What is the SMILES notation for 2-(6-methyl-1,3-benzothiazol-2-yl)cyclopropane-1-carboxylic acid?
The canonical SMILES for 2-(6-methyl-1,3-benzothiazol-2-yl)cyclopropane-1-carboxylic acid is Cc1ccc2nc(C3CC3C(=O)O)sc2c1.
What is the InChIKey of 2-(6-methyl-1,3-benzothiazol-2-yl)cyclopropane-1-carboxylic acid?
The InChIKey is HLURSGXKLUTMQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2S/c1-6-2-3-9-10(4-6)16-11(13-9)7-5-8(7)12(14)15/h2-4,7-8H,5H2,1H3,(H,14,15).
What are the key properties of 2-(6-methyl-1,3-benzothiazol-2-yl)cyclopropane-1-carboxylic acid?
2-(6-methyl-1,3-benzothiazol-2-yl)cyclopropane-1-carboxylic acid has a molecular weight of 233.29 g/mol, XLogP of 2.79, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methyl-1,3-benzothiazol-2-yl)cyclopropane-1-carboxylic acid is sourced from PubChem (CID 79142019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).