C9H12N2OS — CID 79142056
2-(2-amino-5-methylphenyl)sulfanylacetamide (PubChem CID 79142056) has the molecular formula C9H12N2OS and a molecular weight of 196.28 g/mol. Its IUPAC name is 2-(2-amino-5-methylphenyl)sulfanylacetamide.
| Compound Name | 2-(2-amino-5-methylphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 79142056 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 2-(2-amino-5-methylphenyl)sulfanylacetamide |
| SMILES | Cc1ccc(N)c(SCC(N)=O)c1 |
| InChI | InChI=1S/C9H12N2OS/c1-6-2-3-7(10)8(4-6)13-5-9(11)12/h2-4H,5,10H2,1H3,(H2,11,12) |
| InChIKey | GRIBSCZNMUUZHC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|