About 1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]pyrazol-4-amine
1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]pyrazol-4-amine (PubChem CID 79142451) has the molecular formula C12H12N4S
and a molecular weight of 244.32 g/mol. Its IUPAC name is 1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]pyrazol-4-amine.
Molecular Properties
| Compound Name | 1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]pyrazol-4-amine |
| PubChem CID | 79142451 |
| Molecular Formula | C12H12N4S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]pyrazol-4-amine |
| SMILES | Cc1ccc2nc(Cn3cc(N)cn3)sc2c1 |
| InChI | InChI=1S/C12H12N4S/c1-8-2-3-10-11(4-8)17-12(15-10)7-16-6-9(13)5-14-16/h2-6H,7,13H2,1H3 |
| InChIKey | IZERBTJCAGJOTH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]pyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]pyrazol-4-amine?
The IUPAC name of 1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]pyrazol-4-amine (CID 79142451) is 1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]pyrazol-4-amine.
What is the SMILES notation for 1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]pyrazol-4-amine?
The canonical SMILES for 1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]pyrazol-4-amine is Cc1ccc2nc(Cn3cc(N)cn3)sc2c1.
What is the InChIKey of 1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]pyrazol-4-amine?
The InChIKey is IZERBTJCAGJOTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4S/c1-8-2-3-10-11(4-8)17-12(15-10)7-16-6-9(13)5-14-16/h2-6H,7,13H2,1H3.
What are the key properties of 1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]pyrazol-4-amine?
1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]pyrazol-4-amine has a molecular weight of 244.32 g/mol, XLogP of 2.43, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]pyrazol-4-amine is sourced from PubChem (CID 79142451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).