C12H16F3NOS — CID 79143320
4-methyl-2-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]aniline (PubChem CID 79143320) has the molecular formula C12H16F3NOS and a molecular weight of 279.33 g/mol. Its IUPAC name is 4-methyl-2-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]aniline.
| Compound Name | 4-methyl-2-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]aniline |
|---|---|
| PubChem CID | 79143320 |
| Molecular Formula | C12H16F3NOS |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 4-methyl-2-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]aniline |
| SMILES | Cc1ccc(N)c(SCCCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H16F3NOS/c1-9-3-4-10(16)11(7-9)18-6-2-5-17-8-12(13,14)15/h3-4,7H,2,5-6,8,16H2,1H3 |
| InChIKey | AKJUZTCLJXCIII-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|