C14H16FN3S — CID 79143804
6-fluoro-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-1,3-benzothiazol-2-amine (PubChem CID 79143804) has the molecular formula C14H16FN3S and a molecular weight of 277.37 g/mol. Its IUPAC name is 6-fluoro-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-fluoro-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79143804 |
| Molecular Formula | C14H16FN3S |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 6-fluoro-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-1,3-benzothiazol-2-amine |
| SMILES | Fc1ccc2nc(NC3CCN4CCCC34)sc2c1 |
| InChI | InChI=1S/C14H16FN3S/c15-9-3-4-11-13(8-9)19-14(17-11)16-10-5-7-18-6-1-2-12(10)18/h3-4,8,10,12H,1-2,5-7H2,(H,16,17) |
| InChIKey | FPYVUCJCPSKGIT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |