About 2-[(5S,7R)-3-bromo-1-adamantyl]-N-tert-butylacetamide
2-[(5S,7R)-3-bromo-1-adamantyl]-N-tert-butylacetamide (PubChem CID 7914409) has the molecular formula C16H26BrNO
and a molecular weight of 328.29 g/mol. Its IUPAC name is 2-[(5S,7R)-3-bromo-1-adamantyl]-N-tert-butylacetamide.
Molecular Properties
| Compound Name | 2-[(5S,7R)-3-bromo-1-adamantyl]-N-tert-butylacetamide |
| PubChem CID | 7914409 |
| Molecular Formula | C16H26BrNO |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2-[(5S,7R)-3-bromo-1-adamantyl]-N-tert-butylacetamide |
| SMILES | CC(C)(C)NC(=O)CC12C[C@@H]3C[C@@H](CC(Br)(C3)C1)C2 |
| InChI | InChI=1S/C16H26BrNO/c1-14(2,3)18-13(19)9-15-5-11-4-12(6-15)8-16(17,7-11)10-15/h11-12H,4-10H2,1-3H3,(H,18,19)/t11-,12+,15?,16? |
| InChIKey | YNLJLRWXJALECR-RJAIZQQDSA-N |
| XLogP | 4.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5S,7R)-3-bromo-1-adamantyl]-N-tert-butylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5S,7R)-3-bromo-1-adamantyl]-N-tert-butylacetamide?
The IUPAC name of 2-[(5S,7R)-3-bromo-1-adamantyl]-N-tert-butylacetamide (CID 7914409) is 2-[(5S,7R)-3-bromo-1-adamantyl]-N-tert-butylacetamide.
What is the SMILES notation for 2-[(5S,7R)-3-bromo-1-adamantyl]-N-tert-butylacetamide?
The canonical SMILES for 2-[(5S,7R)-3-bromo-1-adamantyl]-N-tert-butylacetamide is CC(C)(C)NC(=O)CC12C[C@@H]3C[C@@H](CC(Br)(C3)C1)C2.
What is the InChIKey of 2-[(5S,7R)-3-bromo-1-adamantyl]-N-tert-butylacetamide?
The InChIKey is YNLJLRWXJALECR-RJAIZQQDSA-N. The full InChI is InChI=1S/C16H26BrNO/c1-14(2,3)18-13(19)9-15-5-11-4-12(6-15)8-16(17,7-11)10-15/h11-12H,4-10H2,1-3H3,(H,18,19)/t11-,12+,15?,16?.
What are the key properties of 2-[(5S,7R)-3-bromo-1-adamantyl]-N-tert-butylacetamide?
2-[(5S,7R)-3-bromo-1-adamantyl]-N-tert-butylacetamide has a molecular weight of 328.29 g/mol, XLogP of 4.03, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5S,7R)-3-bromo-1-adamantyl]-N-tert-butylacetamide is sourced from PubChem (CID 7914409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).