C10H18N2O2 — CID 79144930
2-methoxy-N-[(5-propan-2-yl-1,3-oxazol-4-yl)methyl]ethanamine (PubChem CID 79144930) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 2-methoxy-N-[(5-propan-2-yl-1,3-oxazol-4-yl)methyl]ethanamine.
| Compound Name | 2-methoxy-N-[(5-propan-2-yl-1,3-oxazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 79144930 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 2-methoxy-N-[(5-propan-2-yl-1,3-oxazol-4-yl)methyl]ethanamine |
| SMILES | COCCNCc1ncoc1C(C)C |
| InChI | InChI=1S/C10H18N2O2/c1-8(2)10-9(12-7-14-10)6-11-4-5-13-3/h7-8,11H,4-6H2,1-3H3 |
| InChIKey | IZNZXHMQCHHDGB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|