About [5-(ethoxymethyl)-1,3-oxazol-4-yl]methanol
[5-(ethoxymethyl)-1,3-oxazol-4-yl]methanol (PubChem CID 79145426) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is [5-(ethoxymethyl)-1,3-oxazol-4-yl]methanol.
Molecular Properties
| Compound Name | [5-(ethoxymethyl)-1,3-oxazol-4-yl]methanol |
| PubChem CID | 79145426 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | [5-(ethoxymethyl)-1,3-oxazol-4-yl]methanol |
| SMILES | CCOCc1ocnc1CO |
| InChI | InChI=1S/C7H11NO3/c1-2-10-4-7-6(3-9)8-5-11-7/h5,9H,2-4H2,1H3 |
| InChIKey | VMYVAAJNQYQIOT-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(ethoxymethyl)-1,3-oxazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(ethoxymethyl)-1,3-oxazol-4-yl]methanol?
The IUPAC name of [5-(ethoxymethyl)-1,3-oxazol-4-yl]methanol (CID 79145426) is [5-(ethoxymethyl)-1,3-oxazol-4-yl]methanol.
What is the SMILES notation for [5-(ethoxymethyl)-1,3-oxazol-4-yl]methanol?
The canonical SMILES for [5-(ethoxymethyl)-1,3-oxazol-4-yl]methanol is CCOCc1ocnc1CO.
What is the InChIKey of [5-(ethoxymethyl)-1,3-oxazol-4-yl]methanol?
The InChIKey is VMYVAAJNQYQIOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3/c1-2-10-4-7-6(3-9)8-5-11-7/h5,9H,2-4H2,1H3.
What are the key properties of [5-(ethoxymethyl)-1,3-oxazol-4-yl]methanol?
[5-(ethoxymethyl)-1,3-oxazol-4-yl]methanol has a molecular weight of 157.17 g/mol, XLogP of 0.70, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(ethoxymethyl)-1,3-oxazol-4-yl]methanol is sourced from PubChem (CID 79145426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).