C10H12ClNO2S — CID 79146704
3-(4-amino-3-chlorophenyl)sulfanylbutanoic acid (PubChem CID 79146704) has the molecular formula C10H12ClNO2S and a molecular weight of 245.73 g/mol. Its IUPAC name is 3-(4-amino-3-chlorophenyl)sulfanylbutanoic acid.
| Compound Name | 3-(4-amino-3-chlorophenyl)sulfanylbutanoic acid |
|---|---|
| PubChem CID | 79146704 |
| Molecular Formula | C10H12ClNO2S |
| Molecular Weight | 245.73 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 3-(4-amino-3-chlorophenyl)sulfanylbutanoic acid |
| SMILES | CC(CC(=O)O)Sc1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C10H12ClNO2S/c1-6(4-10(13)14)15-7-2-3-9(12)8(11)5-7/h2-3,5-6H,4,12H2,1H3,(H,13,14) |
| InChIKey | SNAICVYPBHYKBA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.73 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|