About [4-(4-methyl-1,3-benzothiazol-2-yl)-1,3-thiazol-2-yl]methanamine
[4-(4-methyl-1,3-benzothiazol-2-yl)-1,3-thiazol-2-yl]methanamine (PubChem CID 79146804) has the molecular formula C12H11N3S2
and a molecular weight of 261.38 g/mol. Its IUPAC name is [4-(4-methyl-1,3-benzothiazol-2-yl)-1,3-thiazol-2-yl]methanamine.
Molecular Properties
| Compound Name | [4-(4-methyl-1,3-benzothiazol-2-yl)-1,3-thiazol-2-yl]methanamine |
| PubChem CID | 79146804 |
| Molecular Formula | C12H11N3S2 |
| Molecular Weight | 261.38 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | [4-(4-methyl-1,3-benzothiazol-2-yl)-1,3-thiazol-2-yl]methanamine |
| SMILES | Cc1cccc2sc(-c3csc(CN)n3)nc12 |
| InChI | InChI=1S/C12H11N3S2/c1-7-3-2-4-9-11(7)15-12(17-9)8-6-16-10(5-13)14-8/h2-4,6H,5,13H2,1H3 |
| InChIKey | SCBVTZHXAKZVBX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(4-methyl-1,3-benzothiazol-2-yl)-1,3-thiazol-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-methyl-1,3-benzothiazol-2-yl)-1,3-thiazol-2-yl]methanamine?
The IUPAC name of [4-(4-methyl-1,3-benzothiazol-2-yl)-1,3-thiazol-2-yl]methanamine (CID 79146804) is [4-(4-methyl-1,3-benzothiazol-2-yl)-1,3-thiazol-2-yl]methanamine.
What is the SMILES notation for [4-(4-methyl-1,3-benzothiazol-2-yl)-1,3-thiazol-2-yl]methanamine?
The canonical SMILES for [4-(4-methyl-1,3-benzothiazol-2-yl)-1,3-thiazol-2-yl]methanamine is Cc1cccc2sc(-c3csc(CN)n3)nc12.
What is the InChIKey of [4-(4-methyl-1,3-benzothiazol-2-yl)-1,3-thiazol-2-yl]methanamine?
The InChIKey is SCBVTZHXAKZVBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3S2/c1-7-3-2-4-9-11(7)15-12(17-9)8-6-16-10(5-13)14-8/h2-4,6H,5,13H2,1H3.
What are the key properties of [4-(4-methyl-1,3-benzothiazol-2-yl)-1,3-thiazol-2-yl]methanamine?
[4-(4-methyl-1,3-benzothiazol-2-yl)-1,3-thiazol-2-yl]methanamine has a molecular weight of 261.38 g/mol, XLogP of 3.19, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-methyl-1,3-benzothiazol-2-yl)-1,3-thiazol-2-yl]methanamine is sourced from PubChem (CID 79146804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).