C11H13N3OS — CID 79146919
2-methyl-6-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]aniline (PubChem CID 79146919) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 2-methyl-6-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]aniline.
| Compound Name | 2-methyl-6-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 79146919 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-methyl-6-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]aniline |
| SMILES | Cc1nc(CSc2cccc(C)c2N)no1 |
| InChI | InChI=1S/C11H13N3OS/c1-7-4-3-5-9(11(7)12)16-6-10-13-8(2)15-14-10/h3-5H,6,12H2,1-2H3 |
| InChIKey | SATRHRXQHZXEKY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|