C12H14N2OS — CID 79147339
2-(2-amino-3-methylphenyl)sulfanyl-N-prop-2-ynylacetamide (PubChem CID 79147339) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is 2-(2-amino-3-methylphenyl)sulfanyl-N-prop-2-ynylacetamide.
| Compound Name | 2-(2-amino-3-methylphenyl)sulfanyl-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 79147339 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 2-(2-amino-3-methylphenyl)sulfanyl-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)CSc1cccc(C)c1N |
| InChI | InChI=1S/C12H14N2OS/c1-3-7-14-11(15)8-16-10-6-4-5-9(2)12(10)13/h1,4-6H,7-8,13H2,2H3,(H,14,15) |
| InChIKey | SJQDXDKLNKIEAT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|