C14H13N3OS2 — CID 79147880
2-(4-amino-3-methylphenyl)sulfanyl-N-(3-cyanothiophen-2-yl)acetamide (PubChem CID 79147880) has the molecular formula C14H13N3OS2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 2-(4-amino-3-methylphenyl)sulfanyl-N-(3-cyanothiophen-2-yl)acetamide.
| Compound Name | 2-(4-amino-3-methylphenyl)sulfanyl-N-(3-cyanothiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 79147880 |
| Molecular Formula | C14H13N3OS2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 2-(4-amino-3-methylphenyl)sulfanyl-N-(3-cyanothiophen-2-yl)acetamide |
| SMILES | Cc1cc(SCC(=O)Nc2sccc2C#N)ccc1N |
| InChI | InChI=1S/C14H13N3OS2/c1-9-6-11(2-3-12(9)16)20-8-13(18)17-14-10(7-15)4-5-19-14/h2-6H,8,16H2,1H3,(H,17,18) |
| InChIKey | GBAULHKNZBJVAG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|