About 2-chloro-4-(1,2,4-oxadiazol-5-ylmethylsulfanyl)aniline
2-chloro-4-(1,2,4-oxadiazol-5-ylmethylsulfanyl)aniline (PubChem CID 79149109) has the molecular formula C9H8ClN3OS
and a molecular weight of 241.70 g/mol. Its IUPAC name is 2-chloro-4-(1,2,4-oxadiazol-5-ylmethylsulfanyl)aniline.
Molecular Properties
| Compound Name | 2-chloro-4-(1,2,4-oxadiazol-5-ylmethylsulfanyl)aniline |
| PubChem CID | 79149109 |
| Molecular Formula | C9H8ClN3OS |
| Molecular Weight | 241.70 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 2-chloro-4-(1,2,4-oxadiazol-5-ylmethylsulfanyl)aniline |
| SMILES | Nc1ccc(SCc2ncno2)cc1Cl |
| InChI | InChI=1S/C9H8ClN3OS/c10-7-3-6(1-2-8(7)11)15-4-9-12-5-13-14-9/h1-3,5H,4,11H2 |
| InChIKey | WMZQRDRXSIUDCF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.70 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-(1,2,4-oxadiazol-5-ylmethylsulfanyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(1,2,4-oxadiazol-5-ylmethylsulfanyl)aniline?
The IUPAC name of 2-chloro-4-(1,2,4-oxadiazol-5-ylmethylsulfanyl)aniline (CID 79149109) is 2-chloro-4-(1,2,4-oxadiazol-5-ylmethylsulfanyl)aniline.
What is the SMILES notation for 2-chloro-4-(1,2,4-oxadiazol-5-ylmethylsulfanyl)aniline?
The canonical SMILES for 2-chloro-4-(1,2,4-oxadiazol-5-ylmethylsulfanyl)aniline is Nc1ccc(SCc2ncno2)cc1Cl.
What is the InChIKey of 2-chloro-4-(1,2,4-oxadiazol-5-ylmethylsulfanyl)aniline?
The InChIKey is WMZQRDRXSIUDCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClN3OS/c10-7-3-6(1-2-8(7)11)15-4-9-12-5-13-14-9/h1-3,5H,4,11H2.
What are the key properties of 2-chloro-4-(1,2,4-oxadiazol-5-ylmethylsulfanyl)aniline?
2-chloro-4-(1,2,4-oxadiazol-5-ylmethylsulfanyl)aniline has a molecular weight of 241.70 g/mol, XLogP of 2.60, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(1,2,4-oxadiazol-5-ylmethylsulfanyl)aniline is sourced from PubChem (CID 79149109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).