About 4-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfanylthiophene-2-carboxylic acid
4-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfanylthiophene-2-carboxylic acid (PubChem CID 79149340) has the molecular formula C9H8F3NO3S2
and a molecular weight of 299.30 g/mol. Its IUPAC name is 4-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfanylthiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfanylthiophene-2-carboxylic acid |
| PubChem CID | 79149340 |
| Molecular Formula | C9H8F3NO3S2 |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | 4-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfanylthiophene-2-carboxylic acid |
| SMILES | O=C(CSc1csc(C(=O)O)c1)NCC(F)(F)F |
| InChI | InChI=1S/C9H8F3NO3S2/c10-9(11,12)4-13-7(14)3-17-5-1-6(8(15)16)18-2-5/h1-2H,3-4H2,(H,13,14)(H,15,16) |
| InChIKey | ZTRQZBIPKOTQDZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfanylthiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfanylthiophene-2-carboxylic acid?
The IUPAC name of 4-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfanylthiophene-2-carboxylic acid (CID 79149340) is 4-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfanylthiophene-2-carboxylic acid.
What is the SMILES notation for 4-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfanylthiophene-2-carboxylic acid?
The canonical SMILES for 4-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfanylthiophene-2-carboxylic acid is O=C(CSc1csc(C(=O)O)c1)NCC(F)(F)F.
What is the InChIKey of 4-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfanylthiophene-2-carboxylic acid?
The InChIKey is ZTRQZBIPKOTQDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F3NO3S2/c10-9(11,12)4-13-7(14)3-17-5-1-6(8(15)16)18-2-5/h1-2H,3-4H2,(H,13,14)(H,15,16).
What are the key properties of 4-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfanylthiophene-2-carboxylic acid?
4-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfanylthiophene-2-carboxylic acid has a molecular weight of 299.30 g/mol, XLogP of 2.22, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfanylthiophene-2-carboxylic acid is sourced from PubChem (CID 79149340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).