About 6-methyl-2-[(2,4,6-trifluoroanilino)methyl]pyridin-3-ol
6-methyl-2-[(2,4,6-trifluoroanilino)methyl]pyridin-3-ol (PubChem CID 79150854) has the molecular formula C13H11F3N2O
and a molecular weight of 268.24 g/mol. Its IUPAC name is 6-methyl-2-[(2,4,6-trifluoroanilino)methyl]pyridin-3-ol.
Molecular Properties
| Compound Name | 6-methyl-2-[(2,4,6-trifluoroanilino)methyl]pyridin-3-ol |
| PubChem CID | 79150854 |
| Molecular Formula | C13H11F3N2O |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 6-methyl-2-[(2,4,6-trifluoroanilino)methyl]pyridin-3-ol |
| SMILES | Cc1ccc(O)c(CNc2c(F)cc(F)cc2F)n1 |
| InChI | InChI=1S/C13H11F3N2O/c1-7-2-3-12(19)11(18-7)6-17-13-9(15)4-8(14)5-10(13)16/h2-5,17,19H,6H2,1H3 |
| InChIKey | VAYMSCYZIRVIAH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methyl-2-[(2,4,6-trifluoroanilino)methyl]pyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-[(2,4,6-trifluoroanilino)methyl]pyridin-3-ol?
The IUPAC name of 6-methyl-2-[(2,4,6-trifluoroanilino)methyl]pyridin-3-ol (CID 79150854) is 6-methyl-2-[(2,4,6-trifluoroanilino)methyl]pyridin-3-ol.
What is the SMILES notation for 6-methyl-2-[(2,4,6-trifluoroanilino)methyl]pyridin-3-ol?
The canonical SMILES for 6-methyl-2-[(2,4,6-trifluoroanilino)methyl]pyridin-3-ol is Cc1ccc(O)c(CNc2c(F)cc(F)cc2F)n1.
What is the InChIKey of 6-methyl-2-[(2,4,6-trifluoroanilino)methyl]pyridin-3-ol?
The InChIKey is VAYMSCYZIRVIAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F3N2O/c1-7-2-3-12(19)11(18-7)6-17-13-9(15)4-8(14)5-10(13)16/h2-5,17,19H,6H2,1H3.
What are the key properties of 6-methyl-2-[(2,4,6-trifluoroanilino)methyl]pyridin-3-ol?
6-methyl-2-[(2,4,6-trifluoroanilino)methyl]pyridin-3-ol has a molecular weight of 268.24 g/mol, XLogP of 3.13, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-[(2,4,6-trifluoroanilino)methyl]pyridin-3-ol is sourced from PubChem (CID 79150854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).