C14H22N2O3 — CID 79151614
methyl 3-[[6-methyl-2-[(propan-2-ylamino)methyl]-3-pyridinyl]oxy]propanoate (PubChem CID 79151614) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is methyl 3-[[6-methyl-2-[(propan-2-ylamino)methyl]-3-pyridinyl]oxy]propanoate.
| Compound Name | methyl 3-[[6-methyl-2-[(propan-2-ylamino)methyl]-3-pyridinyl]oxy]propanoate |
|---|---|
| PubChem CID | 79151614 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | methyl 3-[[6-methyl-2-[(propan-2-ylamino)methyl]-3-pyridinyl]oxy]propanoate |
| SMILES | COC(=O)CCOc1ccc(C)nc1CNC(C)C |
| InChI | InChI=1S/C14H22N2O3/c1-10(2)15-9-12-13(6-5-11(3)16-12)19-8-7-14(17)18-4/h5-6,10,15H,7-9H2,1-4H3 |
| InChIKey | BINLNHGLPXRRSF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |