C13H27N3O — CID 79153266
1,1,3-trimethyl-3-[4-(propylamino)cyclohexyl]urea (PubChem CID 79153266) has the molecular formula C13H27N3O and a molecular weight of 241.38 g/mol. Its IUPAC name is 1,1,3-trimethyl-3-[4-(propylamino)cyclohexyl]urea.
| Compound Name | 1,1,3-trimethyl-3-[4-(propylamino)cyclohexyl]urea |
|---|---|
| PubChem CID | 79153266 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | 1,1,3-trimethyl-3-[4-(propylamino)cyclohexyl]urea |
| SMILES | CCCNC1CCC(N(C)C(=O)N(C)C)CC1 |
| InChI | InChI=1S/C13H27N3O/c1-5-10-14-11-6-8-12(9-7-11)16(4)13(17)15(2)3/h11-12,14H,5-10H2,1-4H3 |
| InChIKey | PHILHTSRYHPXBR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |