C12H19N3O — CID 79153335
3-[(2-aminophenyl)methyl]-1,1-diethylurea (PubChem CID 79153335) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-[(2-aminophenyl)methyl]-1,1-diethylurea.
| Compound Name | 3-[(2-aminophenyl)methyl]-1,1-diethylurea |
|---|---|
| PubChem CID | 79153335 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 3-[(2-aminophenyl)methyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NCc1ccccc1N |
| InChI | InChI=1S/C12H19N3O/c1-3-15(4-2)12(16)14-9-10-7-5-6-8-11(10)13/h5-8H,3-4,9,13H2,1-2H3,(H,14,16) |
| InChIKey | AXBNDCZFOMFLJM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|